C22H24N6O3 — CID 97006497
(3R)-1-[2-[2-(3-cyanobenzoyl)hydrazinyl]-2-oxoethyl]-N-(5-methyl-2-pyridinyl)piperidine-3-carboxamide (PubChem CID 97006497) has the molecular formula C22H24N6O3 and a molecular weight of 420.47 g/mol. Its IUPAC name is (3R)-1-[2-[2-(3-cyanobenzoyl)hydrazinyl]-2-oxoethyl]-N-(5-methyl-2-pyridinyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-[2-[2-(3-cyanobenzoyl)hydrazinyl]-2-oxoethyl]-N-(5-methyl-2-pyridinyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 97006497 |
| Molecular Formula | C22H24N6O3 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | (3R)-1-[2-[2-(3-cyanobenzoyl)hydrazinyl]-2-oxoethyl]-N-(5-methyl-2-pyridinyl)piperidine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@@H]2CCCN(CC(=O)NNC(=O)c3cccc(C#N)c3)C2)nc1 |
| InChI | InChI=1S/C22H24N6O3/c1-15-7-8-19(24-12-15)25-21(30)18-6-3-9-28(13-18)14-20(29)26-27-22(31)17-5-2-4-16(10-17)11-23/h2,4-5,7-8,10,12,18H,3,6,9,13-14H2,1H3,(H,26,29)(H,27,31)(H,24,25,30)/t18-/m1/s1 |
| InChIKey | ICFMTIMVRICCQV-GOSISDBHSA-N |
| XLogP | 1.37 |
| TPSA | 127.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|