C26H33N3O3 — CID 97007484
N-(3-acetamido-2-methylphenyl)-N'-[(S)-[(1S,3S)-3-methylcyclohexyl]-(2-methylphenyl)methyl]oxamide (PubChem CID 97007484) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is N-(3-acetamido-2-methylphenyl)-N'-[(S)-[(1S,3S)-3-methylcyclohexyl]-(2-methylphenyl)methyl]oxamide.
| Compound Name | N-(3-acetamido-2-methylphenyl)-N'-[(S)-[(1S,3S)-3-methylcyclohexyl]-(2-methylphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 97007484 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | N-(3-acetamido-2-methylphenyl)-N'-[(S)-[(1S,3S)-3-methylcyclohexyl]-(2-methylphenyl)methyl]oxamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)C(=O)N[C@H](c2ccccc2C)[C@H]2CCC[C@H](C)C2)c1C |
| InChI | InChI=1S/C26H33N3O3/c1-16-9-7-11-20(15-16)24(21-12-6-5-10-17(21)2)29-26(32)25(31)28-23-14-8-13-22(18(23)3)27-19(4)30/h5-6,8,10,12-14,16,20,24H,7,9,11,15H2,1-4H3,(H,27,30)(H,28,31)(H,29,32)/t16-,20-,24-/m0/s1 |
| InChIKey | WQRRTBKGNADZIP-YFBXQHAESA-N |
| XLogP | 4.88 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|