C19H23N3O4S2 — CID 97008863
[(4aS,8aS)-1,1-dioxo-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl]-[2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]phenyl]methanone (PubChem CID 97008863) has the molecular formula C19H23N3O4S2 and a molecular weight of 421.54 g/mol. Its IUPAC name is [(4aS,8aS)-1,1-dioxo-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl]-[2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]phenyl]methanone.
| Compound Name | [(4aS,8aS)-1,1-dioxo-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl]-[2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]phenyl]methanone |
|---|---|
| PubChem CID | 97008863 |
| Molecular Formula | C19H23N3O4S2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | [(4aS,8aS)-1,1-dioxo-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl]-[2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]phenyl]methanone |
| SMILES | Cc1nc(CSc2ccccc2C(=O)N2CCS(=O)(=O)[C@H]3CCCC[C@@H]32)no1 |
| InChI | InChI=1S/C19H23N3O4S2/c1-13-20-18(21-26-13)12-27-16-8-4-2-6-14(16)19(23)22-10-11-28(24,25)17-9-5-3-7-15(17)22/h2,4,6,8,15,17H,3,5,7,9-12H2,1H3/t15-,17-/m0/s1 |
| InChIKey | HHISCKVZKRJOFP-RDJZCZTQSA-N |
| XLogP | 2.85 |
| TPSA | 93.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_thiomorph_Z(1)', 'substructure': 'N/A'} |
|---|