C13H15Cl2NO3 — CID 97010668
3,4-dichloro-2-hydroxy-N-[2-[(2S)-oxolan-2-yl]ethyl]benzamide (PubChem CID 97010668) has the molecular formula C13H15Cl2NO3 and a molecular weight of 304.17 g/mol. Its IUPAC name is 3,4-dichloro-2-hydroxy-N-[2-[(2S)-oxolan-2-yl]ethyl]benzamide.
| Compound Name | 3,4-dichloro-2-hydroxy-N-[2-[(2S)-oxolan-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 97010668 |
| Molecular Formula | C13H15Cl2NO3 |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 3,4-dichloro-2-hydroxy-N-[2-[(2S)-oxolan-2-yl]ethyl]benzamide |
| SMILES | O=C(NCC[C@@H]1CCCO1)c1ccc(Cl)c(Cl)c1O |
| InChI | InChI=1S/C13H15Cl2NO3/c14-10-4-3-9(12(17)11(10)15)13(18)16-6-5-8-2-1-7-19-8/h3-4,8,17H,1-2,5-7H2,(H,16,18)/t8-/m0/s1 |
| InChIKey | FWNFQNWHAGEVBL-QMMMGPOBSA-N |
| XLogP | 3.00 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |