C16H18Cl2N4O4 — CID 97010768
1-[[(5R)-3-(2,4-dichlorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]amino]-3-[[(2R)-oxolan-2-yl]methyl]urea (PubChem CID 97010768) has the molecular formula C16H18Cl2N4O4 and a molecular weight of 401.25 g/mol. Its IUPAC name is 1-[[(5R)-3-(2,4-dichlorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]amino]-3-[[(2R)-oxolan-2-yl]methyl]urea.
| Compound Name | 1-[[(5R)-3-(2,4-dichlorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]amino]-3-[[(2R)-oxolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 97010768 |
| Molecular Formula | C16H18Cl2N4O4 |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 1-[[(5R)-3-(2,4-dichlorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]amino]-3-[[(2R)-oxolan-2-yl]methyl]urea |
| SMILES | O=C(NC[C@H]1CCCO1)NNC(=O)[C@H]1CC(c2ccc(Cl)cc2Cl)=NO1 |
| InChI | InChI=1S/C16H18Cl2N4O4/c17-9-3-4-11(12(18)6-9)13-7-14(26-22-13)15(23)20-21-16(24)19-8-10-2-1-5-25-10/h3-4,6,10,14H,1-2,5,7-8H2,(H,20,23)(H2,19,21,24)/t10-,14-/m1/s1 |
| InChIKey | JTRJSKIXWJWRED-QMTHXVAHSA-N |
| XLogP | 2.00 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|