C15H27N3O5 — CID 97012257
tert-butyl N-[(2R)-3-methyl-1-oxo-1-[2-[(2S)-oxolane-2-carbonyl]hydrazinyl]butan-2-yl]carbamate (PubChem CID 97012257) has the molecular formula C15H27N3O5 and a molecular weight of 329.40 g/mol. Its IUPAC name is tert-butyl N-[(2R)-3-methyl-1-oxo-1-[2-[(2S)-oxolane-2-carbonyl]hydrazinyl]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-3-methyl-1-oxo-1-[2-[(2S)-oxolane-2-carbonyl]hydrazinyl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 97012257 |
| Molecular Formula | C15H27N3O5 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | tert-butyl N-[(2R)-3-methyl-1-oxo-1-[2-[(2S)-oxolane-2-carbonyl]hydrazinyl]butan-2-yl]carbamate |
| SMILES | CC(C)[C@@H](NC(=O)OC(C)(C)C)C(=O)NNC(=O)[C@@H]1CCCO1 |
| InChI | InChI=1S/C15H27N3O5/c1-9(2)11(16-14(21)23-15(3,4)5)13(20)18-17-12(19)10-7-6-8-22-10/h9-11H,6-8H2,1-5H3,(H,16,21)(H,17,19)(H,18,20)/t10-,11+/m0/s1 |
| InChIKey | YWAIGJCRTQTBJX-WDEREUQCSA-N |
| XLogP | 0.86 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|