C26H29N3O3 — CID 97013755
[4-[[(2S)-oxolan-2-yl]methoxy]phenyl]-[4-(quinolin-8-ylmethyl)piperazin-1-yl]methanone (PubChem CID 97013755) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is [4-[[(2S)-oxolan-2-yl]methoxy]phenyl]-[4-(quinolin-8-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | [4-[[(2S)-oxolan-2-yl]methoxy]phenyl]-[4-(quinolin-8-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 97013755 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | [4-[[(2S)-oxolan-2-yl]methoxy]phenyl]-[4-(quinolin-8-ylmethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(OC[C@@H]2CCCO2)cc1)N1CCN(Cc2cccc3cccnc23)CC1 |
| InChI | InChI=1S/C26H29N3O3/c30-26(21-8-10-23(11-9-21)32-19-24-7-3-17-31-24)29-15-13-28(14-16-29)18-22-5-1-4-20-6-2-12-27-25(20)22/h1-2,4-6,8-12,24H,3,7,13-19H2/t24-/m0/s1 |
| InChIKey | BGWCMTKOCCUWGR-DEOSSOPVSA-N |
| XLogP | 3.75 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |