C21H23N3O3 — CID 97015203
(2R)-N-[(3R)-5-oxo-1-phenylpyrrolidin-3-yl]-2-phenylmorpholine-4-carboxamide (PubChem CID 97015203) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is (2R)-N-[(3R)-5-oxo-1-phenylpyrrolidin-3-yl]-2-phenylmorpholine-4-carboxamide.
| Compound Name | (2R)-N-[(3R)-5-oxo-1-phenylpyrrolidin-3-yl]-2-phenylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 97015203 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | (2R)-N-[(3R)-5-oxo-1-phenylpyrrolidin-3-yl]-2-phenylmorpholine-4-carboxamide |
| SMILES | O=C(N[C@@H]1CC(=O)N(c2ccccc2)C1)N1CCO[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C21H23N3O3/c25-20-13-17(14-24(20)18-9-5-2-6-10-18)22-21(26)23-11-12-27-19(15-23)16-7-3-1-4-8-16/h1-10,17,19H,11-15H2,(H,22,26)/t17-,19+/m1/s1 |
| InChIKey | QGHZHUKAOVIZIF-MJGOQNOKSA-N |
| XLogP | 2.58 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |