C19H26N2O4 — CID 97016848
3-[(3R)-2,3-dihydro-1-benzofuran-3-yl]-1,1-bis[[(2S)-oxolan-2-yl]methyl]urea (PubChem CID 97016848) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 3-[(3R)-2,3-dihydro-1-benzofuran-3-yl]-1,1-bis[[(2S)-oxolan-2-yl]methyl]urea.
| Compound Name | 3-[(3R)-2,3-dihydro-1-benzofuran-3-yl]-1,1-bis[[(2S)-oxolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 97016848 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 3-[(3R)-2,3-dihydro-1-benzofuran-3-yl]-1,1-bis[[(2S)-oxolan-2-yl]methyl]urea |
| SMILES | O=C(N[C@H]1COc2ccccc21)N(C[C@@H]1CCCO1)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C19H26N2O4/c22-19(20-17-13-25-18-8-2-1-7-16(17)18)21(11-14-5-3-9-23-14)12-15-6-4-10-24-15/h1-2,7-8,14-15,17H,3-6,9-13H2,(H,20,22)/t14-,15-,17-/m0/s1 |
| InChIKey | LYAIWYATNRPBAY-ZOBUZTSGSA-N |
| XLogP | 2.49 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |