C19H28N4O2 — CID 97017820
6-[[(1R,3S)-3-(propan-2-ylcarbamoyl)cyclohexyl]amino]-N-prop-2-enylpyridine-3-carboxamide (PubChem CID 97017820) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 6-[[(1R,3S)-3-(propan-2-ylcarbamoyl)cyclohexyl]amino]-N-prop-2-enylpyridine-3-carboxamide.
| Compound Name | 6-[[(1R,3S)-3-(propan-2-ylcarbamoyl)cyclohexyl]amino]-N-prop-2-enylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 97017820 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 6-[[(1R,3S)-3-(propan-2-ylcarbamoyl)cyclohexyl]amino]-N-prop-2-enylpyridine-3-carboxamide |
| SMILES | C=CCNC(=O)c1ccc(N[C@@H]2CCC[C@H](C(=O)NC(C)C)C2)nc1 |
| InChI | InChI=1S/C19H28N4O2/c1-4-10-20-18(24)15-8-9-17(21-12-15)23-16-7-5-6-14(11-16)19(25)22-13(2)3/h4,8-9,12-14,16H,1,5-7,10-11H2,2-3H3,(H,20,24)(H,21,23)(H,22,25)/t14-,16+/m0/s1 |
| InChIKey | MAPSIANZYYTCFJ-GOEBONIOSA-N |
| XLogP | 2.49 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|