C18H23N5O — CID 96566222
N-prop-2-enyl-6-[[(1S,2R)-2-pyrazol-1-ylcyclohexyl]amino]pyridine-3-carboxamide (PubChem CID 96566222) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is N-prop-2-enyl-6-[[(1S,2R)-2-pyrazol-1-ylcyclohexyl]amino]pyridine-3-carboxamide.
| Compound Name | N-prop-2-enyl-6-[[(1S,2R)-2-pyrazol-1-ylcyclohexyl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 96566222 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | N-prop-2-enyl-6-[[(1S,2R)-2-pyrazol-1-ylcyclohexyl]amino]pyridine-3-carboxamide |
| SMILES | C=CCNC(=O)c1ccc(N[C@H]2CCCC[C@H]2n2cccn2)nc1 |
| InChI | InChI=1S/C18H23N5O/c1-2-10-19-18(24)14-8-9-17(20-13-14)22-15-6-3-4-7-16(15)23-12-5-11-21-23/h2,5,8-9,11-13,15-16H,1,3-4,6-7,10H2,(H,19,24)(H,20,22)/t15-,16+/m0/s1 |
| InChIKey | HKVOPJNFVCJYIF-JKSUJKDBSA-N |
| XLogP | 2.79 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|