C13H16ClN5 — CID 95968560
6-chloro-N-[(1R,2S)-2-pyrazol-1-ylcyclohexyl]pyrazin-2-amine (PubChem CID 95968560) has the molecular formula C13H16ClN5 and a molecular weight of 277.76 g/mol. Its IUPAC name is 6-chloro-N-[(1R,2S)-2-pyrazol-1-ylcyclohexyl]pyrazin-2-amine.
| Compound Name | 6-chloro-N-[(1R,2S)-2-pyrazol-1-ylcyclohexyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 95968560 |
| Molecular Formula | C13H16ClN5 |
| Molecular Weight | 277.76 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 6-chloro-N-[(1R,2S)-2-pyrazol-1-ylcyclohexyl]pyrazin-2-amine |
| SMILES | Clc1cncc(N[C@@H]2CCCC[C@@H]2n2cccn2)n1 |
| InChI | InChI=1S/C13H16ClN5/c14-12-8-15-9-13(18-12)17-10-4-1-2-5-11(10)19-7-3-6-16-19/h3,6-11H,1-2,4-5H2,(H,17,18)/t10-,11+/m1/s1 |
| InChIKey | ZSCHZJJMUKPZMK-MNOVXSKESA-N |
| XLogP | 2.92 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.76 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |