C10H14ClN3O — CID 130905693
6-chloro-N-(2,5-dimethyloxolan-3-yl)pyrazin-2-amine (PubChem CID 130905693) has the molecular formula C10H14ClN3O and a molecular weight of 227.70 g/mol. Its IUPAC name is 6-chloro-N-(2,5-dimethyloxolan-3-yl)pyrazin-2-amine.
| Compound Name | 6-chloro-N-(2,5-dimethyloxolan-3-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 130905693 |
| Molecular Formula | C10H14ClN3O |
| Molecular Weight | 227.70 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 6-chloro-N-(2,5-dimethyloxolan-3-yl)pyrazin-2-amine |
| SMILES | CC1CC(Nc2cncc(Cl)n2)C(C)O1 |
| InChI | InChI=1S/C10H14ClN3O/c1-6-3-8(7(2)15-6)13-10-5-12-4-9(11)14-10/h4-8H,3H2,1-2H3,(H,13,14) |
| InChIKey | SDGMYQLRIVMZDE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.70 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |