C12H15ClN2O3 — CID 114035408
(2,6-dimethyloxan-4-yl) 6-chloropyrazine-2-carboxylate (PubChem CID 114035408) has the molecular formula C12H15ClN2O3 and a molecular weight of 270.72 g/mol. Its IUPAC name is (2,6-dimethyloxan-4-yl) 6-chloropyrazine-2-carboxylate.
| Compound Name | (2,6-dimethyloxan-4-yl) 6-chloropyrazine-2-carboxylate |
|---|---|
| PubChem CID | 114035408 |
| Molecular Formula | C12H15ClN2O3 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | (2,6-dimethyloxan-4-yl) 6-chloropyrazine-2-carboxylate |
| SMILES | CC1CC(OC(=O)c2cncc(Cl)n2)CC(C)O1 |
| InChI | InChI=1S/C12H15ClN2O3/c1-7-3-9(4-8(2)17-7)18-12(16)10-5-14-6-11(13)15-10/h5-9H,3-4H2,1-2H3 |
| InChIKey | LGJYHWAEOSHGRY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |