About (2,6-dimethyloxan-4-yl) 2-chloro-5-sulfanylbenzoate
(2,6-dimethyloxan-4-yl) 2-chloro-5-sulfanylbenzoate (PubChem CID 107019029) has the molecular formula C14H17ClO3S
and a molecular weight of 300.81 g/mol. Its IUPAC name is (2,6-dimethyloxan-4-yl) 2-chloro-5-sulfanylbenzoate.
Molecular Properties
| Compound Name | (2,6-dimethyloxan-4-yl) 2-chloro-5-sulfanylbenzoate |
| PubChem CID | 107019029 |
| Molecular Formula | C14H17ClO3S |
| Molecular Weight | 300.81 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | (2,6-dimethyloxan-4-yl) 2-chloro-5-sulfanylbenzoate |
| SMILES | CC1CC(OC(=O)c2cc(S)ccc2Cl)CC(C)O1 |
| InChI | InChI=1S/C14H17ClO3S/c1-8-5-10(6-9(2)17-8)18-14(16)12-7-11(19)3-4-13(12)15/h3-4,7-10,19H,5-6H2,1-2H3 |
| InChIKey | VIQVBWBUONAVRZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.81 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2,6-dimethyloxan-4-yl) 2-chloro-5-sulfanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-dimethyloxan-4-yl) 2-chloro-5-sulfanylbenzoate?
The IUPAC name of (2,6-dimethyloxan-4-yl) 2-chloro-5-sulfanylbenzoate (CID 107019029) is (2,6-dimethyloxan-4-yl) 2-chloro-5-sulfanylbenzoate.
What is the SMILES notation for (2,6-dimethyloxan-4-yl) 2-chloro-5-sulfanylbenzoate?
The canonical SMILES for (2,6-dimethyloxan-4-yl) 2-chloro-5-sulfanylbenzoate is CC1CC(OC(=O)c2cc(S)ccc2Cl)CC(C)O1.
What is the InChIKey of (2,6-dimethyloxan-4-yl) 2-chloro-5-sulfanylbenzoate?
The InChIKey is VIQVBWBUONAVRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17ClO3S/c1-8-5-10(6-9(2)17-8)18-14(16)12-7-11(19)3-4-13(12)15/h3-4,7-10,19H,5-6H2,1-2H3.
What are the key properties of (2,6-dimethyloxan-4-yl) 2-chloro-5-sulfanylbenzoate?
(2,6-dimethyloxan-4-yl) 2-chloro-5-sulfanylbenzoate has a molecular weight of 300.81 g/mol, XLogP of 3.74, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dimethyloxan-4-yl) 2-chloro-5-sulfanylbenzoate is sourced from PubChem (CID 107019029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).