C15H23N5 — CID 99622517
cis-(1R,2S)-N-(3-imidazol-1-ylpropyl)-2-pyrazol-1-ylcyclohexan-1-amine (PubChem CID 99622517) has the molecular formula C15H23N5 and a molecular weight of 273.38 g/mol. Its IUPAC name is cis-(1R,2S)-N-(3-imidazol-1-ylpropyl)-2-pyrazol-1-ylcyclohexan-1-amine.
| Compound Name | cis-(1R,2S)-N-(3-imidazol-1-ylpropyl)-2-pyrazol-1-ylcyclohexan-1-amine |
|---|---|
| PubChem CID | 99622517 |
| Molecular Formula | C15H23N5 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.20 |
| IUPAC Name | cis-(1R,2S)-N-(3-imidazol-1-ylpropyl)-2-pyrazol-1-ylcyclohexan-1-amine |
| SMILES | c1cnn([C@H]2CCCC[C@H]2NCCCn2ccnc2)c1 |
| InChI | InChI=1S/C15H23N5/c1-2-6-15(20-11-4-8-18-20)14(5-1)17-7-3-10-19-12-9-16-13-19/h4,8-9,11-15,17H,1-3,5-7,10H2/t14-,15+/m1/s1 |
| InChIKey | CXRHCWFNECHFQD-CABCVRRESA-N |
| XLogP | 2.24 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|