C16H25N3 — CID 43392168
N-(3-imidazol-1-ylpropyl)tricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 43392168) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)tricyclo[5.2.1.02,6]decan-8-amine.
| Compound Name | N-(3-imidazol-1-ylpropyl)tricyclo[5.2.1.02,6]decan-8-amine |
|---|---|
| PubChem CID | 43392168 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)tricyclo[5.2.1.02,6]decan-8-amine |
| SMILES | c1cn(CCCNC2CC3CC2C2CCCC32)cn1 |
| InChI | InChI=1S/C16H25N3/c1-3-13-12-9-15(14(13)4-1)16(10-12)18-5-2-7-19-8-6-17-11-19/h6,8,11-16,18H,1-5,7,9-10H2 |
| InChIKey | JUDPQVXHUFZLGO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|