C15H14N2O3 — CID 97017887
trans-(1R,2R)-N-(naphthalen-1-ylmethyl)-2-nitrocyclopropane-1-carboxamide (PubChem CID 97017887) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is trans-(1R,2R)-N-(naphthalen-1-ylmethyl)-2-nitrocyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-(naphthalen-1-ylmethyl)-2-nitrocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 97017887 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | trans-(1R,2R)-N-(naphthalen-1-ylmethyl)-2-nitrocyclopropane-1-carboxamide |
| SMILES | O=C(NCc1cccc2ccccc12)[C@@H]1C[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C15H14N2O3/c18-15(13-8-14(13)17(19)20)16-9-11-6-3-5-10-4-1-2-7-12(10)11/h1-7,13-14H,8-9H2,(H,16,18)/t13-,14-/m1/s1 |
| InChIKey | SXRJJLDWFCFZCY-ZIAGYGMSSA-N |
| XLogP | 2.12 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|