C22H24N4O2 — CID 97018091
[(3R)-1-benzo[g]quinazolin-4-ylpiperidin-3-yl]-morpholin-4-ylmethanone (PubChem CID 97018091) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is [(3R)-1-benzo[g]quinazolin-4-ylpiperidin-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [(3R)-1-benzo[g]quinazolin-4-ylpiperidin-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 97018091 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | [(3R)-1-benzo[g]quinazolin-4-ylpiperidin-3-yl]-morpholin-4-ylmethanone |
| SMILES | O=C([C@@H]1CCCN(c2ncnc3cc4ccccc4cc23)C1)N1CCOCC1 |
| InChI | InChI=1S/C22H24N4O2/c27-22(25-8-10-28-11-9-25)18-6-3-7-26(14-18)21-19-12-16-4-1-2-5-17(16)13-20(19)23-15-24-21/h1-2,4-5,12-13,15,18H,3,6-11,14H2/t18-/m1/s1 |
| InChIKey | GQNIPZSUGZHPRV-GOSISDBHSA-N |
| XLogP | 2.86 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|