C24H21N3O2 — CID 134210616
1-(5-naphthalen-2-ylquinazolin-4-yl)piperidine-3-carboxylic acid (PubChem CID 134210616) has the molecular formula C24H21N3O2 and a molecular weight of 383.45 g/mol. Its IUPAC name is 1-(5-naphthalen-2-ylquinazolin-4-yl)piperidine-3-carboxylic acid.
| Compound Name | 1-(5-naphthalen-2-ylquinazolin-4-yl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 134210616 |
| Molecular Formula | C24H21N3O2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 1-(5-naphthalen-2-ylquinazolin-4-yl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(c2ncnc3cccc(-c4ccc5ccccc5c4)c23)C1 |
| InChI | InChI=1S/C24H21N3O2/c28-24(29)19-7-4-12-27(14-19)23-22-20(8-3-9-21(22)25-15-26-23)18-11-10-16-5-1-2-6-17(16)13-18/h1-3,5-6,8-11,13,15,19H,4,7,12,14H2,(H,28,29) |
| InChIKey | PUQVYOIGOOISSF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |