C20H18FN3O2 — CID 134220206
1-[5-(3-fluorophenyl)quinazolin-4-yl]piperidine-3-carboxylic acid (PubChem CID 134220206) has the molecular formula C20H18FN3O2 and a molecular weight of 351.38 g/mol. Its IUPAC name is 1-[5-(3-fluorophenyl)quinazolin-4-yl]piperidine-3-carboxylic acid.
| Compound Name | 1-[5-(3-fluorophenyl)quinazolin-4-yl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 134220206 |
| Molecular Formula | C20H18FN3O2 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 1-[5-(3-fluorophenyl)quinazolin-4-yl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(c2ncnc3cccc(-c4cccc(F)c4)c23)C1 |
| InChI | InChI=1S/C20H18FN3O2/c21-15-6-1-4-13(10-15)16-7-2-8-17-18(16)19(23-12-22-17)24-9-3-5-14(11-24)20(25)26/h1-2,4,6-8,10,12,14H,3,5,9,11H2,(H,25,26) |
| InChIKey | MURXJQUZLJITQQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |