C24H25N3O3 — CID 142278514
3-[1-[5-(3,5-dimethylphenyl)quinazolin-4-yl]piperidin-3-yl]-3-oxopropanoic acid (PubChem CID 142278514) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is 3-[1-[5-(3,5-dimethylphenyl)quinazolin-4-yl]piperidin-3-yl]-3-oxopropanoic acid.
| Compound Name | 3-[1-[5-(3,5-dimethylphenyl)quinazolin-4-yl]piperidin-3-yl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 142278514 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 3-[1-[5-(3,5-dimethylphenyl)quinazolin-4-yl]piperidin-3-yl]-3-oxopropanoic acid |
| SMILES | Cc1cc(C)cc(-c2cccc3ncnc(N4CCCC(C(=O)CC(=O)O)C4)c23)c1 |
| InChI | InChI=1S/C24H25N3O3/c1-15-9-16(2)11-18(10-15)19-6-3-7-20-23(19)24(26-14-25-20)27-8-4-5-17(13-27)21(28)12-22(29)30/h3,6-7,9-11,14,17H,4-5,8,12-13H2,1-2H3,(H,29,30) |
| InChIKey | HHMZRMOOAWIVAC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|