C20H18Cl2N4O — CID 134210536
1-[5-(3,4-dichlorophenyl)quinazolin-4-yl]piperidine-3-carboxamide (PubChem CID 134210536) has the molecular formula C20H18Cl2N4O and a molecular weight of 401.30 g/mol. Its IUPAC name is 1-[5-(3,4-dichlorophenyl)quinazolin-4-yl]piperidine-3-carboxamide.
| Compound Name | 1-[5-(3,4-dichlorophenyl)quinazolin-4-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 134210536 |
| Molecular Formula | C20H18Cl2N4O |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 1-[5-(3,4-dichlorophenyl)quinazolin-4-yl]piperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(c2ncnc3cccc(-c4ccc(Cl)c(Cl)c4)c23)C1 |
| InChI | InChI=1S/C20H18Cl2N4O/c21-15-7-6-12(9-16(15)22)14-4-1-5-17-18(14)20(25-11-24-17)26-8-2-3-13(10-26)19(23)27/h1,4-7,9,11,13H,2-3,8,10H2,(H2,23,27) |
| InChIKey | LQDWLVYCYAUYKX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |