C20H16Cl2N4 — CID 134210287
1-[5-(3,4-dichlorophenyl)quinazolin-4-yl]piperidine-3-carbonitrile (PubChem CID 134210287) has the molecular formula C20H16Cl2N4 and a molecular weight of 383.28 g/mol. Its IUPAC name is 1-[5-(3,4-dichlorophenyl)quinazolin-4-yl]piperidine-3-carbonitrile.
| Compound Name | 1-[5-(3,4-dichlorophenyl)quinazolin-4-yl]piperidine-3-carbonitrile |
|---|---|
| PubChem CID | 134210287 |
| Molecular Formula | C20H16Cl2N4 |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 1-[5-(3,4-dichlorophenyl)quinazolin-4-yl]piperidine-3-carbonitrile |
| SMILES | N#CC1CCCN(c2ncnc3cccc(-c4ccc(Cl)c(Cl)c4)c23)C1 |
| InChI | InChI=1S/C20H16Cl2N4/c21-16-7-6-14(9-17(16)22)15-4-1-5-18-19(15)20(25-12-24-18)26-8-2-3-13(10-23)11-26/h1,4-7,9,12-13H,2-3,8,11H2 |
| InChIKey | NVXOSZGBMYLFAV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |