C21H22Cl2N6 — CID 142278475
(Z)-2-[1-[5-(3,4-dichlorophenyl)quinazolin-4-yl]piperidin-3-yl]-2-hydrazinylethenamine (PubChem CID 142278475) has the molecular formula C21H22Cl2N6 and a molecular weight of 429.36 g/mol. Its IUPAC name is (Z)-2-[1-[5-(3,4-dichlorophenyl)quinazolin-4-yl]piperidin-3-yl]-2-hydrazinylethenamine.
| Compound Name | (Z)-2-[1-[5-(3,4-dichlorophenyl)quinazolin-4-yl]piperidin-3-yl]-2-hydrazinylethenamine |
|---|---|
| PubChem CID | 142278475 |
| Molecular Formula | C21H22Cl2N6 |
| Molecular Weight | 429.36 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | (Z)-2-[1-[5-(3,4-dichlorophenyl)quinazolin-4-yl]piperidin-3-yl]-2-hydrazinylethenamine |
| SMILES | N/C=C(\NN)C1CCCN(c2ncnc3cccc(-c4ccc(Cl)c(Cl)c4)c23)C1 |
| InChI | InChI=1S/C21H22Cl2N6/c22-16-7-6-13(9-17(16)23)15-4-1-5-18-20(15)21(27-12-26-18)29-8-2-3-14(11-29)19(10-24)28-25/h1,4-7,9-10,12,14,28H,2-3,8,11,24-25H2/b19-10- |
| InChIKey | LQWLSWXYKQTQDX-GRSHGNNSSA-N |
| XLogP | 4.08 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|