C21H20Cl2N4O2 — CID 134210579
methyl 1-[2-amino-5-(3,4-dichlorophenyl)quinazolin-4-yl]piperidine-3-carboxylate (PubChem CID 134210579) has the molecular formula C21H20Cl2N4O2 and a molecular weight of 431.32 g/mol. Its IUPAC name is methyl 1-[2-amino-5-(3,4-dichlorophenyl)quinazolin-4-yl]piperidine-3-carboxylate.
| Compound Name | methyl 1-[2-amino-5-(3,4-dichlorophenyl)quinazolin-4-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 134210579 |
| Molecular Formula | C21H20Cl2N4O2 |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | methyl 1-[2-amino-5-(3,4-dichlorophenyl)quinazolin-4-yl]piperidine-3-carboxylate |
| SMILES | COC(=O)C1CCCN(c2nc(N)nc3cccc(-c4ccc(Cl)c(Cl)c4)c23)C1 |
| InChI | InChI=1S/C21H20Cl2N4O2/c1-29-20(28)13-4-3-9-27(11-13)19-18-14(12-7-8-15(22)16(23)10-12)5-2-6-17(18)25-21(24)26-19/h2,5-8,10,13H,3-4,9,11H2,1H3,(H2,24,25,26) |
| InChIKey | LIHSRSROTZPYLN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |