C22H21F2N3O2 — CID 134210589
methyl 1-[8-fluoro-5-(4-fluoro-3-methylphenyl)quinazolin-4-yl]piperidine-3-carboxylate (PubChem CID 134210589) has the molecular formula C22H21F2N3O2 and a molecular weight of 397.43 g/mol. Its IUPAC name is methyl 1-[8-fluoro-5-(4-fluoro-3-methylphenyl)quinazolin-4-yl]piperidine-3-carboxylate.
| Compound Name | methyl 1-[8-fluoro-5-(4-fluoro-3-methylphenyl)quinazolin-4-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 134210589 |
| Molecular Formula | C22H21F2N3O2 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | methyl 1-[8-fluoro-5-(4-fluoro-3-methylphenyl)quinazolin-4-yl]piperidine-3-carboxylate |
| SMILES | COC(=O)C1CCCN(c2ncnc3c(F)ccc(-c4ccc(F)c(C)c4)c23)C1 |
| InChI | InChI=1S/C22H21F2N3O2/c1-13-10-14(5-7-17(13)23)16-6-8-18(24)20-19(16)21(26-12-25-20)27-9-3-4-15(11-27)22(28)29-2/h5-8,10,12,15H,3-4,9,11H2,1-2H3 |
| InChIKey | IFTPINYFJSHUJC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |