C19H16ClF2N3 — CID 134220296
5-(3-chloro-4-fluorophenyl)-8-fluoro-4-piperidin-1-ylquinazoline (PubChem CID 134220296) has the molecular formula C19H16ClF2N3 and a molecular weight of 359.81 g/mol. Its IUPAC name is 5-(3-chloro-4-fluorophenyl)-8-fluoro-4-piperidin-1-ylquinazoline.
| Compound Name | 5-(3-chloro-4-fluorophenyl)-8-fluoro-4-piperidin-1-ylquinazoline |
|---|---|
| PubChem CID | 134220296 |
| Molecular Formula | C19H16ClF2N3 |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 5-(3-chloro-4-fluorophenyl)-8-fluoro-4-piperidin-1-ylquinazoline |
| SMILES | Fc1ccc(-c2ccc(F)c3ncnc(N4CCCCC4)c23)cc1Cl |
| InChI | InChI=1S/C19H16ClF2N3/c20-14-10-12(4-6-15(14)21)13-5-7-16(22)18-17(13)19(24-11-23-18)25-8-2-1-3-9-25/h4-7,10-11H,1-3,8-9H2 |
| InChIKey | NDJHMJRRNWCVKK-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |