C20H16Cl2FN3O — CID 142278653
5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-amine;1-ethenylcyclopropane-1-carbaldehyde (PubChem CID 142278653) has the molecular formula C20H16Cl2FN3O and a molecular weight of 404.27 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-amine;1-ethenylcyclopropane-1-carbaldehyde.
| Compound Name | 5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-amine;1-ethenylcyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 142278653 |
| Molecular Formula | C20H16Cl2FN3O |
| Molecular Weight | 404.27 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-amine;1-ethenylcyclopropane-1-carbaldehyde |
| SMILES | C=CC1(C=O)CC1.Nc1ncnc2c(F)ccc(-c3ccc(Cl)c(Cl)c3)c12 |
| InChI | InChI=1S/C14H8Cl2FN3.C6H8O/c15-9-3-1-7(5-10(9)16)8-2-4-11(17)13-12(8)14(18)20-6-19-13;1-2-6(5-7)3-4-6/h1-6H,(H2,18,19,20);2,5H,1,3-4H2 |
| InChIKey | PWAKSBSQGDLRDE-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.27 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|