About 2-cyanobut-3-enoic acid;5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-amine
2-cyanobut-3-enoic acid;5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-amine (PubChem CID 142278540) has the molecular formula C19H13Cl2FN4O2
and a molecular weight of 419.24 g/mol. Its IUPAC name is 2-cyanobut-3-enoic acid;5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-amine.
Molecular Properties
| Compound Name | 2-cyanobut-3-enoic acid;5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-amine |
| PubChem CID | 142278540 |
| Molecular Formula | C19H13Cl2FN4O2 |
| Molecular Weight | 419.24 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | 2-cyanobut-3-enoic acid;5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-amine |
| SMILES | C=CC(C#N)C(=O)O.Nc1ncnc2c(F)ccc(-c3ccc(Cl)c(Cl)c3)c12 |
| InChI | InChI=1S/C14H8Cl2FN3.C5H5NO2/c15-9-3-1-7(5-10(9)16)8-2-4-11(17)13-12(8)14(18)20-6-19-13;1-2-4(3-6)5(7)8/h1-6H,(H2,18,19,20);2,4H,1H2,(H,7,8) |
| InChIKey | ZFNTXIBUHWJQSG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 112.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.24 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanobut-3-enoic acid;5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanobut-3-enoic acid;5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-amine?
The IUPAC name of 2-cyanobut-3-enoic acid;5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-amine (CID 142278540) is 2-cyanobut-3-enoic acid;5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-amine.
What is the SMILES notation for 2-cyanobut-3-enoic acid;5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-amine?
The canonical SMILES for 2-cyanobut-3-enoic acid;5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-amine is C=CC(C#N)C(=O)O.Nc1ncnc2c(F)ccc(-c3ccc(Cl)c(Cl)c3)c12.
What is the InChIKey of 2-cyanobut-3-enoic acid;5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-amine?
The InChIKey is ZFNTXIBUHWJQSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8Cl2FN3.C5H5NO2/c15-9-3-1-7(5-10(9)16)8-2-4-11(17)13-12(8)14(18)20-6-19-13;1-2-4(3-6)5(7)8/h1-6H,(H2,18,19,20);2,4H,1H2,(H,7,8).
What are the key properties of 2-cyanobut-3-enoic acid;5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-amine?
2-cyanobut-3-enoic acid;5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-amine has a molecular weight of 419.24 g/mol, XLogP of 4.72, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanobut-3-enoic acid;5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-amine is sourced from PubChem (CID 142278540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).