C19H13Cl2FN4O2 — CID 142278540
2-cyanobut-3-enoic acid;5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-amine (PubChem CID 142278540) has the molecular formula C19H13Cl2FN4O2 and a molecular weight of 419.24 g/mol. Its IUPAC name is 2-cyanobut-3-enoic acid;5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-amine.
| Compound Name | 2-cyanobut-3-enoic acid;5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-amine |
|---|---|
| PubChem CID | 142278540 |
| Molecular Formula | C19H13Cl2FN4O2 |
| Molecular Weight | 419.24 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | 2-cyanobut-3-enoic acid;5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-amine |
| SMILES | C=CC(C#N)C(=O)O.Nc1ncnc2c(F)ccc(-c3ccc(Cl)c(Cl)c3)c12 |
| InChI | InChI=1S/C14H8Cl2FN3.C5H5NO2/c15-9-3-1-7(5-10(9)16)8-2-4-11(17)13-12(8)14(18)20-6-19-13;1-2-4(3-6)5(7)8/h1-6H,(H2,18,19,20);2,4H,1H2,(H,7,8) |
| InChIKey | ZFNTXIBUHWJQSG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 112.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.24 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|