About methyl 1-[5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-yl]-2-methylpiperidine-3-carboxylate
methyl 1-[5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-yl]-2-methylpiperidine-3-carboxylate (PubChem CID 134210631) has the molecular formula C22H20Cl2FN3O2
and a molecular weight of 448.33 g/mol. Its IUPAC name is methyl 1-[5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-yl]-2-methylpiperidine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-yl]-2-methylpiperidine-3-carboxylate |
| PubChem CID | 134210631 |
| Molecular Formula | C22H20Cl2FN3O2 |
| Molecular Weight | 448.33 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | methyl 1-[5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-yl]-2-methylpiperidine-3-carboxylate |
| SMILES | COC(=O)C1CCCN(c2ncnc3c(F)ccc(-c4ccc(Cl)c(Cl)c4)c23)C1C |
| InChI | InChI=1S/C22H20Cl2FN3O2/c1-12-14(22(29)30-2)4-3-9-28(12)21-19-15(13-5-7-16(23)17(24)10-13)6-8-18(25)20(19)26-11-27-21/h5-8,10-12,14H,3-4,9H2,1-2H3 |
| InChIKey | FSOZMIBVGMGEIX-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.33 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 1-[5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-yl]-2-methylpiperidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-yl]-2-methylpiperidine-3-carboxylate?
The IUPAC name of methyl 1-[5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-yl]-2-methylpiperidine-3-carboxylate (CID 134210631) is methyl 1-[5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-yl]-2-methylpiperidine-3-carboxylate.
What is the SMILES notation for methyl 1-[5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-yl]-2-methylpiperidine-3-carboxylate?
The canonical SMILES for methyl 1-[5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-yl]-2-methylpiperidine-3-carboxylate is COC(=O)C1CCCN(c2ncnc3c(F)ccc(-c4ccc(Cl)c(Cl)c4)c23)C1C.
What is the InChIKey of methyl 1-[5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-yl]-2-methylpiperidine-3-carboxylate?
The InChIKey is FSOZMIBVGMGEIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20Cl2FN3O2/c1-12-14(22(29)30-2)4-3-9-28(12)21-19-15(13-5-7-16(23)17(24)10-13)6-8-18(25)20(19)26-11-27-21/h5-8,10-12,14H,3-4,9H2,1-2H3.
What are the key properties of methyl 1-[5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-yl]-2-methylpiperidine-3-carboxylate?
methyl 1-[5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-yl]-2-methylpiperidine-3-carboxylate has a molecular weight of 448.33 g/mol, XLogP of 5.52, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-yl]-2-methylpiperidine-3-carboxylate is sourced from PubChem (CID 134210631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).