C20H16Cl2FN3O — CID 142278663
1-[5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-yl]piperidine-3-carbaldehyde (PubChem CID 142278663) has the molecular formula C20H16Cl2FN3O and a molecular weight of 404.27 g/mol. Its IUPAC name is 1-[5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-yl]piperidine-3-carbaldehyde.
| Compound Name | 1-[5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-yl]piperidine-3-carbaldehyde |
|---|---|
| PubChem CID | 142278663 |
| Molecular Formula | C20H16Cl2FN3O |
| Molecular Weight | 404.27 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 1-[5-(3,4-dichlorophenyl)-8-fluoroquinazolin-4-yl]piperidine-3-carbaldehyde |
| SMILES | O=CC1CCCN(c2ncnc3c(F)ccc(-c4ccc(Cl)c(Cl)c4)c23)C1 |
| InChI | InChI=1S/C20H16Cl2FN3O/c21-15-5-3-13(8-16(15)22)14-4-6-17(23)19-18(14)20(25-11-24-19)26-7-1-2-12(9-26)10-27/h3-6,8,10-12H,1-2,7,9H2 |
| InChIKey | NUXIKTVNLNFQPF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.27 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|