C22H21ClF3N3O2 — CID 142278446
1-[5-[3-chloro-5-(trifluoromethyl)phenyl]quinazolin-4-yl]piperidine-3-carbaldehyde;methanol (PubChem CID 142278446) has the molecular formula C22H21ClF3N3O2 and a molecular weight of 451.88 g/mol. Its IUPAC name is 1-[5-[3-chloro-5-(trifluoromethyl)phenyl]quinazolin-4-yl]piperidine-3-carbaldehyde;methanol.
| Compound Name | 1-[5-[3-chloro-5-(trifluoromethyl)phenyl]quinazolin-4-yl]piperidine-3-carbaldehyde;methanol |
|---|---|
| PubChem CID | 142278446 |
| Molecular Formula | C22H21ClF3N3O2 |
| Molecular Weight | 451.88 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 1-[5-[3-chloro-5-(trifluoromethyl)phenyl]quinazolin-4-yl]piperidine-3-carbaldehyde;methanol |
| SMILES | CO.O=CC1CCCN(c2ncnc3cccc(-c4cc(Cl)cc(C(F)(F)F)c4)c23)C1 |
| InChI | InChI=1S/C21H17ClF3N3O.CH4O/c22-16-8-14(7-15(9-16)21(23,24)25)17-4-1-5-18-19(17)20(27-12-26-18)28-6-2-3-13(10-28)11-29;1-2/h1,4-5,7-9,11-13H,2-3,6,10H2;2H,1H3 |
| InChIKey | GIMGVJYQILPQAQ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.88 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|