C18H16ClN3O2S — CID 134210570
1-[5-(4-chlorothiophen-2-yl)quinazolin-4-yl]piperidine-3-carboxylic acid (PubChem CID 134210570) has the molecular formula C18H16ClN3O2S and a molecular weight of 373.87 g/mol. Its IUPAC name is 1-[5-(4-chlorothiophen-2-yl)quinazolin-4-yl]piperidine-3-carboxylic acid.
| Compound Name | 1-[5-(4-chlorothiophen-2-yl)quinazolin-4-yl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 134210570 |
| Molecular Formula | C18H16ClN3O2S |
| Molecular Weight | 373.87 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 1-[5-(4-chlorothiophen-2-yl)quinazolin-4-yl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(c2ncnc3cccc(-c4cc(Cl)cs4)c23)C1 |
| InChI | InChI=1S/C18H16ClN3O2S/c19-12-7-15(25-9-12)13-4-1-5-14-16(13)17(21-10-20-14)22-6-2-3-11(8-22)18(23)24/h1,4-5,7,9-11H,2-3,6,8H2,(H,23,24) |
| InChIKey | YILLHMCNMRCDAA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.87 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |