C17H12ClF2N3O2 — CID 142278549
5-(3-chloro-4-fluorophenyl)-8-fluoroquinazolin-4-amine;prop-2-enoic acid (PubChem CID 142278549) has the molecular formula C17H12ClF2N3O2 and a molecular weight of 363.75 g/mol. Its IUPAC name is 5-(3-chloro-4-fluorophenyl)-8-fluoroquinazolin-4-amine;prop-2-enoic acid.
| Compound Name | 5-(3-chloro-4-fluorophenyl)-8-fluoroquinazolin-4-amine;prop-2-enoic acid |
|---|---|
| PubChem CID | 142278549 |
| Molecular Formula | C17H12ClF2N3O2 |
| Molecular Weight | 363.75 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 5-(3-chloro-4-fluorophenyl)-8-fluoroquinazolin-4-amine;prop-2-enoic acid |
| SMILES | C=CC(=O)O.Nc1ncnc2c(F)ccc(-c3ccc(F)c(Cl)c3)c12 |
| InChI | InChI=1S/C14H8ClF2N3.C3H4O2/c15-9-5-7(1-3-10(9)16)8-2-4-11(17)13-12(8)14(18)20-6-19-13;1-2-3(4)5/h1-6H,(H2,18,19,20);2H,1H2,(H,4,5) |
| InChIKey | RCIWNFRUFQAHLX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.75 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|