C13H9ClFN3O2 — CID 166598087
7-(3-chloro-4-fluorophenyl)-3H-imidazo[4,5-c]pyridine;formic acid (PubChem CID 166598087) has the molecular formula C13H9ClFN3O2 and a molecular weight of 293.69 g/mol. Its IUPAC name is 7-(3-chloro-4-fluorophenyl)-3H-imidazo[4,5-c]pyridine;formic acid.
| Compound Name | 7-(3-chloro-4-fluorophenyl)-3H-imidazo[4,5-c]pyridine;formic acid |
|---|---|
| PubChem CID | 166598087 |
| Molecular Formula | C13H9ClFN3O2 |
| Molecular Weight | 293.69 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 7-(3-chloro-4-fluorophenyl)-3H-imidazo[4,5-c]pyridine;formic acid |
| SMILES | Fc1ccc(-c2cncc3[nH]cnc23)cc1Cl.O=CO |
| InChI | InChI=1S/C12H7ClFN3.CH2O2/c13-9-3-7(1-2-10(9)14)8-4-15-5-11-12(8)17-6-16-11;2-1-3/h1-6H,(H,16,17);1H,(H,2,3) |
| InChIKey | UKKYITBDJPWOIE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.69 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|