C16H16FN3O3 — CID 97018220
2-[[(3R)-1-(4-fluoro-2-nitrophenyl)pyrrolidin-3-yl]oxymethyl]pyridine (PubChem CID 97018220) has the molecular formula C16H16FN3O3 and a molecular weight of 317.32 g/mol. Its IUPAC name is 2-[[(3R)-1-(4-fluoro-2-nitrophenyl)pyrrolidin-3-yl]oxymethyl]pyridine.
| Compound Name | 2-[[(3R)-1-(4-fluoro-2-nitrophenyl)pyrrolidin-3-yl]oxymethyl]pyridine |
|---|---|
| PubChem CID | 97018220 |
| Molecular Formula | C16H16FN3O3 |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-[[(3R)-1-(4-fluoro-2-nitrophenyl)pyrrolidin-3-yl]oxymethyl]pyridine |
| SMILES | O=[N+]([O-])c1cc(F)ccc1N1CC[C@@H](OCc2ccccn2)C1 |
| InChI | InChI=1S/C16H16FN3O3/c17-12-4-5-15(16(9-12)20(21)22)19-8-6-14(10-19)23-11-13-3-1-2-7-18-13/h1-5,7,9,14H,6,8,10-11H2/t14-/m1/s1 |
| InChIKey | AMJRUIDTBJAUPL-CQSZACIVSA-N |
| XLogP | 2.92 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|