C25H22ClN7O5 — CID 175202071
[1-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-6-nitroquinazolin-7-yl]pyrrolidin-3-yl] carbamate (PubChem CID 175202071) has the molecular formula C25H22ClN7O5 and a molecular weight of 535.95 g/mol. Its IUPAC name is [1-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-6-nitroquinazolin-7-yl]pyrrolidin-3-yl] carbamate.
| Compound Name | [1-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-6-nitroquinazolin-7-yl]pyrrolidin-3-yl] carbamate |
|---|---|
| PubChem CID | 175202071 |
| Molecular Formula | C25H22ClN7O5 |
| Molecular Weight | 535.95 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | [1-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-6-nitroquinazolin-7-yl]pyrrolidin-3-yl] carbamate |
| SMILES | NC(=O)OC1CCN(c2cc3ncnc(Nc4ccc(OCc5ccccn5)c(Cl)c4)c3cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C25H22ClN7O5/c26-19-9-15(4-5-23(19)37-13-16-3-1-2-7-28-16)31-24-18-10-22(33(35)36)21(11-20(18)29-14-30-24)32-8-6-17(12-32)38-25(27)34/h1-5,7,9-11,14,17H,6,8,12-13H2,(H2,27,34)(H,29,30,31) |
| InChIKey | NOGNZSKMXRQLSL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 158.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.95 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|