C28H21ClN6O5 — CID 162390766
2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-6-nitroquinazolin-7-yl]ethynyl 3-azabicyclo[3.1.0]hexane-3-carboxylate (PubChem CID 162390766) has the molecular formula C28H21ClN6O5 and a molecular weight of 556.97 g/mol. Its IUPAC name is 2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-6-nitroquinazolin-7-yl]ethynyl 3-azabicyclo[3.1.0]hexane-3-carboxylate.
| Compound Name | 2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-6-nitroquinazolin-7-yl]ethynyl 3-azabicyclo[3.1.0]hexane-3-carboxylate |
|---|---|
| PubChem CID | 162390766 |
| Molecular Formula | C28H21ClN6O5 |
| Molecular Weight | 556.97 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | 2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-6-nitroquinazolin-7-yl]ethynyl 3-azabicyclo[3.1.0]hexane-3-carboxylate |
| SMILES | O=C(OC#Cc1cc2ncnc(Nc3ccc(OCc4ccccn4)c(Cl)c3)c2cc1[N+](=O)[O-])N1CC2CC2C1 |
| InChI | InChI=1S/C28H21ClN6O5/c29-23-11-20(4-5-26(23)40-15-21-3-1-2-7-30-21)33-27-22-12-25(35(37)38)17(10-24(22)31-16-32-27)6-8-39-28(36)34-13-18-9-19(18)14-34/h1-5,7,10-12,16,18-19H,9,13-15H2,(H,31,32,33) |
| InChIKey | WDZCKHKQWMTQIG-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 132.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.97 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|