C26H25ClN6O4 — CID 146469906
N-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]-7-[(1-methylpyrrolidin-3-yl)methoxy]-6-nitroquinazolin-4-amine (PubChem CID 146469906) has the molecular formula C26H25ClN6O4 and a molecular weight of 520.98 g/mol. Its IUPAC name is N-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]-7-[(1-methylpyrrolidin-3-yl)methoxy]-6-nitroquinazolin-4-amine.
| Compound Name | N-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]-7-[(1-methylpyrrolidin-3-yl)methoxy]-6-nitroquinazolin-4-amine |
|---|---|
| PubChem CID | 146469906 |
| Molecular Formula | C26H25ClN6O4 |
| Molecular Weight | 520.98 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | N-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]-7-[(1-methylpyrrolidin-3-yl)methoxy]-6-nitroquinazolin-4-amine |
| SMILES | CN1CCC(COc2cc3ncnc(Nc4ccc(OCc5ccccn5)c(Cl)c4)c3cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C26H25ClN6O4/c1-32-9-7-17(13-32)14-36-25-12-22-20(11-23(25)33(34)35)26(30-16-29-22)31-18-5-6-24(21(27)10-18)37-15-19-4-2-3-8-28-19/h2-6,8,10-12,16-17H,7,9,13-15H2,1H3,(H,29,30,31) |
| InChIKey | ODEOKRLSJHXFRR-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 115.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.98 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|