C17H22N6O2 — CID 97018348
1-[(2S)-2-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)pyrrolidin-1-yl]-4-(pyrimidin-2-ylamino)butan-1-one (PubChem CID 97018348) has the molecular formula C17H22N6O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is 1-[(2S)-2-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)pyrrolidin-1-yl]-4-(pyrimidin-2-ylamino)butan-1-one.
| Compound Name | 1-[(2S)-2-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)pyrrolidin-1-yl]-4-(pyrimidin-2-ylamino)butan-1-one |
|---|---|
| PubChem CID | 97018348 |
| Molecular Formula | C17H22N6O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 1-[(2S)-2-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)pyrrolidin-1-yl]-4-(pyrimidin-2-ylamino)butan-1-one |
| SMILES | O=C(CCCNc1ncccn1)N1CCC[C@H]1c1noc(C2CC2)n1 |
| InChI | InChI=1S/C17H22N6O2/c24-14(5-1-8-18-17-19-9-3-10-20-17)23-11-2-4-13(23)15-21-16(25-22-15)12-6-7-12/h3,9-10,12-13H,1-2,4-8,11H2,(H,18,19,20)/t13-/m0/s1 |
| InChIKey | JCOKSYKFGRJRFK-ZDUSSCGKSA-N |
| XLogP | 2.29 |
| TPSA | 97.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|