C19H20N4O2 — CID 97019806
(2R)-1-N-methyl-2-N-(5-nitroquinolin-6-yl)-1-N-phenylpropane-1,2-diamine (PubChem CID 97019806) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is (2R)-1-N-methyl-2-N-(5-nitroquinolin-6-yl)-1-N-phenylpropane-1,2-diamine.
| Compound Name | (2R)-1-N-methyl-2-N-(5-nitroquinolin-6-yl)-1-N-phenylpropane-1,2-diamine |
|---|---|
| PubChem CID | 97019806 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (2R)-1-N-methyl-2-N-(5-nitroquinolin-6-yl)-1-N-phenylpropane-1,2-diamine |
| SMILES | C[C@H](CN(C)c1ccccc1)Nc1ccc2ncccc2c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H20N4O2/c1-14(13-22(2)15-7-4-3-5-8-15)21-18-11-10-17-16(9-6-12-20-17)19(18)23(24)25/h3-12,14,21H,13H2,1-2H3/t14-/m1/s1 |
| InChIKey | BUCWWGDLHJEVSX-CQSZACIVSA-N |
| XLogP | 4.08 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|