C15H23N3O2S — CID 97019926
(3S)-3-(2-amino-2-oxoethyl)-N-[(2S)-2-thiophen-3-ylpropyl]piperidine-1-carboxamide (PubChem CID 97019926) has the molecular formula C15H23N3O2S and a molecular weight of 309.43 g/mol. Its IUPAC name is (3S)-3-(2-amino-2-oxoethyl)-N-[(2S)-2-thiophen-3-ylpropyl]piperidine-1-carboxamide.
| Compound Name | (3S)-3-(2-amino-2-oxoethyl)-N-[(2S)-2-thiophen-3-ylpropyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 97019926 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (3S)-3-(2-amino-2-oxoethyl)-N-[(2S)-2-thiophen-3-ylpropyl]piperidine-1-carboxamide |
| SMILES | C[C@H](CNC(=O)N1CCC[C@@H](CC(N)=O)C1)c1ccsc1 |
| InChI | InChI=1S/C15H23N3O2S/c1-11(13-4-6-21-10-13)8-17-15(20)18-5-2-3-12(9-18)7-14(16)19/h4,6,10-12H,2-3,5,7-9H2,1H3,(H2,16,19)(H,17,20)/t11-,12+/m1/s1 |
| InChIKey | GNEUSIZDILSFJV-NEPJUHHUSA-N |
| XLogP | 2.15 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |