C16H23N3O2S — CID 86769691
3-oxo-N-(2-thiophen-3-ylpropyl)-2,4,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxamide (PubChem CID 86769691) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is 3-oxo-N-(2-thiophen-3-ylpropyl)-2,4,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxamide.
| Compound Name | 3-oxo-N-(2-thiophen-3-ylpropyl)-2,4,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxamide |
|---|---|
| PubChem CID | 86769691 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 3-oxo-N-(2-thiophen-3-ylpropyl)-2,4,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxamide |
| SMILES | CC(CNC(=O)N1CC(=O)NC2CCCCC21)c1ccsc1 |
| InChI | InChI=1S/C16H23N3O2S/c1-11(12-6-7-22-10-12)8-17-16(21)19-9-15(20)18-13-4-2-3-5-14(13)19/h6-7,10-11,13-14H,2-5,8-9H2,1H3,(H,17,21)(H,18,20) |
| InChIKey | GKTBXBKXZCSWOR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |