About 6-fluoro-8-[[(S)-[(1R)-1-(4-fluorophenyl)ethyl]sulfinyl]methyl]-4H-1,3-benzodioxine
6-fluoro-8-[[(S)-[(1R)-1-(4-fluorophenyl)ethyl]sulfinyl]methyl]-4H-1,3-benzodioxine (PubChem CID 97020731) has the molecular formula C17H16F2O3S
and a molecular weight of 338.38 g/mol. Its IUPAC name is 6-fluoro-8-[[(S)-[(1R)-1-(4-fluorophenyl)ethyl]sulfinyl]methyl]-4H-1,3-benzodioxine.
Molecular Properties
| Compound Name | 6-fluoro-8-[[(S)-[(1R)-1-(4-fluorophenyl)ethyl]sulfinyl]methyl]-4H-1,3-benzodioxine |
| PubChem CID | 97020731 |
| Molecular Formula | C17H16F2O3S |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 6-fluoro-8-[[(S)-[(1R)-1-(4-fluorophenyl)ethyl]sulfinyl]methyl]-4H-1,3-benzodioxine |
| SMILES | C[C@H](c1ccc(F)cc1)[S@@](=O)Cc1cc(F)cc2c1OCOC2 |
| InChI | InChI=1S/C17H16F2O3S/c1-11(12-2-4-15(18)5-3-12)23(20)9-14-7-16(19)6-13-8-21-10-22-17(13)14/h2-7,11H,8-10H2,1H3/t11-,23+/m1/s1 |
| InChIKey | DLLRHLHUNUZWPB-BGJPBQGDSA-N |
| XLogP | 3.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-fluoro-8-[[(S)-[(1R)-1-(4-fluorophenyl)ethyl]sulfinyl]methyl]-4H-1,3-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-8-[[(S)-[(1R)-1-(4-fluorophenyl)ethyl]sulfinyl]methyl]-4H-1,3-benzodioxine?
The IUPAC name of 6-fluoro-8-[[(S)-[(1R)-1-(4-fluorophenyl)ethyl]sulfinyl]methyl]-4H-1,3-benzodioxine (CID 97020731) is 6-fluoro-8-[[(S)-[(1R)-1-(4-fluorophenyl)ethyl]sulfinyl]methyl]-4H-1,3-benzodioxine.
What is the SMILES notation for 6-fluoro-8-[[(S)-[(1R)-1-(4-fluorophenyl)ethyl]sulfinyl]methyl]-4H-1,3-benzodioxine?
The canonical SMILES for 6-fluoro-8-[[(S)-[(1R)-1-(4-fluorophenyl)ethyl]sulfinyl]methyl]-4H-1,3-benzodioxine is C[C@H](c1ccc(F)cc1)[S@@](=O)Cc1cc(F)cc2c1OCOC2.
What is the InChIKey of 6-fluoro-8-[[(S)-[(1R)-1-(4-fluorophenyl)ethyl]sulfinyl]methyl]-4H-1,3-benzodioxine?
The InChIKey is DLLRHLHUNUZWPB-BGJPBQGDSA-N. The full InChI is InChI=1S/C17H16F2O3S/c1-11(12-2-4-15(18)5-3-12)23(20)9-14-7-16(19)6-13-8-21-10-22-17(13)14/h2-7,11H,8-10H2,1H3/t11-,23+/m1/s1.
What are the key properties of 6-fluoro-8-[[(S)-[(1R)-1-(4-fluorophenyl)ethyl]sulfinyl]methyl]-4H-1,3-benzodioxine?
6-fluoro-8-[[(S)-[(1R)-1-(4-fluorophenyl)ethyl]sulfinyl]methyl]-4H-1,3-benzodioxine has a molecular weight of 338.38 g/mol, XLogP of 3.84, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-8-[[(S)-[(1R)-1-(4-fluorophenyl)ethyl]sulfinyl]methyl]-4H-1,3-benzodioxine is sourced from PubChem (CID 97020731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).