methyl 2-amino-3-(6-fluoro-4H-1,3-benzodioxin-8-yl)propanoate

C12H14FNO4 — CID 170883507

IUPACmethyl 2-amino-3-(6-fluoro-4H-1,3-benzodioxin-8-yl)propanoate
SMILESCOC(=O)C(N)Cc1cc(F)cc2c1OCOC2
InChIInChI=1S/C12H14FNO4/c1-16-12(15)10(14)4-7-2-9(13)3-8-5-17-6-18-11(7)8/h2-3,10H,4-6,14H2,1H3
InChIKeyDVAALHWMIYQPRD-UHFFFAOYSA-N
MW255.24 g/mol
LogP0.74
Rot. Bonds3

About methyl 2-amino-3-(6-fluoro-4H-1,3-benzodioxin-8-yl)propanoate

methyl 2-amino-3-(6-fluoro-4H-1,3-benzodioxin-8-yl)propanoate (PubChem CID 170883507) has the molecular formula C12H14FNO4 and a molecular weight of 255.24 g/mol. Its IUPAC name is methyl 2-amino-3-(6-fluoro-4H-1,3-benzodioxin-8-yl)propanoate.

Molecular Properties

Compound Namemethyl 2-amino-3-(6-fluoro-4H-1,3-benzodioxin-8-yl)propanoate
PubChem CID170883507
Molecular FormulaC12H14FNO4
Molecular Weight255.24 g/mol
Exact Mass255.09
IUPAC Namemethyl 2-amino-3-(6-fluoro-4H-1,3-benzodioxin-8-yl)propanoate
SMILESCOC(=O)C(N)Cc1cc(F)cc2c1OCOC2
InChIInChI=1S/C12H14FNO4/c1-16-12(15)10(14)4-7-2-9(13)3-8-5-17-6-18-11(7)8/h2-3,10H,4-6,14H2,1H3
InChIKeyDVAALHWMIYQPRD-UHFFFAOYSA-N
XLogP0.74
TPSA70.78 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.24
LogP ≤ 50.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 2-amino-3-(6-fluoro-4H-1,3-benzodioxin-8-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-amino-3-(6-fluoro-4H-1,3-benzodioxin-8-yl)propanoate?
The IUPAC name of methyl 2-amino-3-(6-fluoro-4H-1,3-benzodioxin-8-yl)propanoate (CID 170883507) is methyl 2-amino-3-(6-fluoro-4H-1,3-benzodioxin-8-yl)propanoate.
What is the SMILES notation for methyl 2-amino-3-(6-fluoro-4H-1,3-benzodioxin-8-yl)propanoate?
The canonical SMILES for methyl 2-amino-3-(6-fluoro-4H-1,3-benzodioxin-8-yl)propanoate is COC(=O)C(N)Cc1cc(F)cc2c1OCOC2.
What is the InChIKey of methyl 2-amino-3-(6-fluoro-4H-1,3-benzodioxin-8-yl)propanoate?
The InChIKey is DVAALHWMIYQPRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14FNO4/c1-16-12(15)10(14)4-7-2-9(13)3-8-5-17-6-18-11(7)8/h2-3,10H,4-6,14H2,1H3.
What are the key properties of methyl 2-amino-3-(6-fluoro-4H-1,3-benzodioxin-8-yl)propanoate?
methyl 2-amino-3-(6-fluoro-4H-1,3-benzodioxin-8-yl)propanoate has a molecular weight of 255.24 g/mol, XLogP of 0.74, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-3-(6-fluoro-4H-1,3-benzodioxin-8-yl)propanoate is sourced from PubChem (CID 170883507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).