C20H20FNO4 — CID 94669794
(E)-N-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-3-(2-methoxyphenyl)prop-2-enamide (PubChem CID 94669794) has the molecular formula C20H20FNO4 and a molecular weight of 357.38 g/mol. Its IUPAC name is (E)-N-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-3-(2-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-3-(2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 94669794 |
| Molecular Formula | C20H20FNO4 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | (E)-N-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-3-(2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccccc1/C=C/C(=O)NCCc1cc(F)cc2c1OCOC2 |
| InChI | InChI=1S/C20H20FNO4/c1-24-18-5-3-2-4-14(18)6-7-19(23)22-9-8-15-10-17(21)11-16-12-25-13-26-20(15)16/h2-7,10-11H,8-9,12-13H2,1H3,(H,22,23)/b7-6+ |
| InChIKey | CBJCIWCCBWIOPG-VOTSOKGWSA-N |
| XLogP | 3.07 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|