C17H15ClFNO4 — CID 9477832
(6-fluoro-4H-1,3-benzodioxin-8-yl)methyl 2-chloro-4,6-dimethylpyridine-3-carboxylate (PubChem CID 9477832) has the molecular formula C17H15ClFNO4 and a molecular weight of 351.76 g/mol. Its IUPAC name is (6-fluoro-4H-1,3-benzodioxin-8-yl)methyl 2-chloro-4,6-dimethylpyridine-3-carboxylate.
| Compound Name | (6-fluoro-4H-1,3-benzodioxin-8-yl)methyl 2-chloro-4,6-dimethylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 9477832 |
| Molecular Formula | C17H15ClFNO4 |
| Molecular Weight | 351.76 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | (6-fluoro-4H-1,3-benzodioxin-8-yl)methyl 2-chloro-4,6-dimethylpyridine-3-carboxylate |
| SMILES | Cc1cc(C)c(C(=O)OCc2cc(F)cc3c2OCOC3)c(Cl)n1 |
| InChI | InChI=1S/C17H15ClFNO4/c1-9-3-10(2)20-16(18)14(9)17(21)23-7-12-5-13(19)4-11-6-22-8-24-15(11)12/h3-5H,6-8H2,1-2H3 |
| InChIKey | HJHBYFOPTUHTRY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.76 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|