C17H16FNO4 — CID 18169718
(6-fluoro-4H-1,3-benzodioxin-8-yl)methyl 2-amino-3-methylbenzoate (PubChem CID 18169718) has the molecular formula C17H16FNO4 and a molecular weight of 317.32 g/mol. Its IUPAC name is (6-fluoro-4H-1,3-benzodioxin-8-yl)methyl 2-amino-3-methylbenzoate.
| Compound Name | (6-fluoro-4H-1,3-benzodioxin-8-yl)methyl 2-amino-3-methylbenzoate |
|---|---|
| PubChem CID | 18169718 |
| Molecular Formula | C17H16FNO4 |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | (6-fluoro-4H-1,3-benzodioxin-8-yl)methyl 2-amino-3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)OCc2cc(F)cc3c2OCOC3)c1N |
| InChI | InChI=1S/C17H16FNO4/c1-10-3-2-4-14(15(10)19)17(20)22-8-12-6-13(18)5-11-7-21-9-23-16(11)12/h2-6H,7-9,19H2,1H3 |
| InChIKey | KRWMWPMRYSLGEU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|