C16H16N2O2S — CID 97020935
N-[(1S)-1-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-2-sulfanylidene-1H-pyridine-3-carboxamide (PubChem CID 97020935) has the molecular formula C16H16N2O2S and a molecular weight of 300.38 g/mol. Its IUPAC name is N-[(1S)-1-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-2-sulfanylidene-1H-pyridine-3-carboxamide.
| Compound Name | N-[(1S)-1-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-2-sulfanylidene-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 97020935 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | N-[(1S)-1-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-2-sulfanylidene-1H-pyridine-3-carboxamide |
| SMILES | C[C@H](NC(=O)c1ccc[nH]c1=S)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C16H16N2O2S/c1-10(11-4-5-14-12(9-11)6-8-20-14)18-15(19)13-3-2-7-17-16(13)21/h2-5,7,9-10H,6,8H2,1H3,(H,17,21)(H,18,19)/t10-/m0/s1 |
| InChIKey | LTTWJNVQQYVACF-JTQLQIEISA-N |
| XLogP | 3.17 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|